C16H23F2NO2 — CID 111122492
1-(2,4-difluorophenyl)-2-[4-(ethoxymethyl)piperidin-1-yl]ethanol (PubChem CID 111122492) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[4-(ethoxymethyl)piperidin-1-yl]ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-[4-(ethoxymethyl)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 111122492 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[4-(ethoxymethyl)piperidin-1-yl]ethanol |
| SMILES | CCOCC1CCN(CC(O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H23F2NO2/c1-2-21-11-12-5-7-19(8-6-12)10-16(20)14-4-3-13(17)9-15(14)18/h3-4,9,12,16,20H,2,5-8,10-11H2,1H3 |
| InChIKey | XRKVWSMXOXNCLS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |