C16H19F2N3O — CID 86773453
1-(2,4-difluorophenyl)-2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]ethanol (PubChem CID 86773453) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 86773453 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]ethanol |
| SMILES | OC(CN1CCC(c2cn[nH]c2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2N3O/c17-13-1-2-14(15(18)7-13)16(22)10-21-5-3-11(4-6-21)12-8-19-20-9-12/h1-2,7-9,11,16,22H,3-6,10H2,(H,19,20) |
| InChIKey | SZBCAHPNWNDAQD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |