C18H19F2NO — CID 100851245
(1S)-1-(2,5-difluorophenyl)-2-[(3S)-3-phenylpyrrolidin-1-yl]ethanol (PubChem CID 100851245) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is (1S)-1-(2,5-difluorophenyl)-2-[(3S)-3-phenylpyrrolidin-1-yl]ethanol.
| Compound Name | (1S)-1-(2,5-difluorophenyl)-2-[(3S)-3-phenylpyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 100851245 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (1S)-1-(2,5-difluorophenyl)-2-[(3S)-3-phenylpyrrolidin-1-yl]ethanol |
| SMILES | O[C@H](CN1CC[C@@H](c2ccccc2)C1)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H19F2NO/c19-15-6-7-17(20)16(10-15)18(22)12-21-9-8-14(11-21)13-4-2-1-3-5-13/h1-7,10,14,18,22H,8-9,11-12H2/t14-,18-/m1/s1 |
| InChIKey | OMEWPFPWQIRGJZ-RDTXWAMCSA-N |
| XLogP | 3.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |