C15H20F2N2O2 — CID 111565375
2-[1-[2-(2,5-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]acetamide (PubChem CID 111565375) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[1-[2-(2,5-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[1-[2-(2,5-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 111565375 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[1-[2-(2,5-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]acetamide |
| SMILES | NC(=O)CC1CCCN(CC(O)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C15H20F2N2O2/c16-11-3-4-13(17)12(7-11)14(20)9-19-5-1-2-10(8-19)6-15(18)21/h3-4,7,10,14,20H,1-2,5-6,8-9H2,(H2,18,21) |
| InChIKey | KRZDJEZSAKDAJF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |