C20H29FN2O4 — CID 90483762
1-[(4-fluorophenyl)methyl]-4-(4-methylcyclohexyl)piperazine;oxalic acid (PubChem CID 90483762) has the molecular formula C20H29FN2O4 and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-(4-methylcyclohexyl)piperazine;oxalic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-(4-methylcyclohexyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 90483762 |
| Molecular Formula | C20H29FN2O4 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-(4-methylcyclohexyl)piperazine;oxalic acid |
| SMILES | CC1CCC(N2CCN(Cc3ccc(F)cc3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H27FN2.C2H2O4/c1-15-2-8-18(9-3-15)21-12-10-20(11-13-21)14-16-4-6-17(19)7-5-16;3-1(4)2(5)6/h4-7,15,18H,2-3,8-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XTULFTKNAHYCIT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|