C42H66N4O4 — CID 134264054
bis(1-[(4-ethylphenyl)methyl]-4-(4-methylcyclohexyl)piperazine);oxalic acid (PubChem CID 134264054) has the molecular formula C42H66N4O4 and a molecular weight of 691.01 g/mol. Its IUPAC name is bis(1-[(4-ethylphenyl)methyl]-4-(4-methylcyclohexyl)piperazine);oxalic acid.
| Compound Name | bis(1-[(4-ethylphenyl)methyl]-4-(4-methylcyclohexyl)piperazine);oxalic acid |
|---|---|
| PubChem CID | 134264054 |
| Molecular Formula | C42H66N4O4 |
| Molecular Weight | 691.01 g/mol |
| Exact Mass | 690.51 |
| IUPAC Name | bis(1-[(4-ethylphenyl)methyl]-4-(4-methylcyclohexyl)piperazine);oxalic acid |
| SMILES | CCc1ccc(CN2CCN(C3CCC(C)CC3)CC2)cc1.CCc1ccc(CN2CCN(C3CCC(C)CC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C20H32N2.C2H2O4/c2*1-3-18-6-8-19(9-7-18)16-21-12-14-22(15-13-21)20-10-4-17(2)5-11-20;3-1(4)2(5)6/h2*6-9,17,20H,3-5,10-16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | CPAXLFVFMRNCOF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.01 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|