C16H23ClFN3O — CID 119884082
(2S)-2-amino-N-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]butanamide (PubChem CID 119884082) has the molecular formula C16H23ClFN3O and a molecular weight of 327.83 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]butanamide.
| Compound Name | (2S)-2-amino-N-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 119884082 |
| Molecular Formula | C16H23ClFN3O |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2S)-2-amino-N-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]butanamide |
| SMILES | CC[C@H](N)C(=O)NC1CCCN(Cc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C16H23ClFN3O/c1-2-15(19)16(22)20-13-4-3-7-21(10-13)9-11-5-6-12(18)8-14(11)17/h5-6,8,13,15H,2-4,7,9-10,19H2,1H3,(H,20,22)/t13?,15-/m0/s1 |
| InChIKey | MGQIXCXHJAMQDM-WUJWULDRSA-N |
| XLogP | 2.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |