C18H19ClFN3O2 — CID 122053759
6-[[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]amino]pyridine-2-carboxylic acid (PubChem CID 122053759) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is 6-[[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053759 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 6-[[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]amino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NC2CCCN(Cc3ccc(F)cc3Cl)C2)n1 |
| InChI | InChI=1S/C18H19ClFN3O2/c19-15-9-13(20)7-6-12(15)10-23-8-2-3-14(11-23)21-17-5-1-4-16(22-17)18(24)25/h1,4-7,9,14H,2-3,8,10-11H2,(H,21,22)(H,24,25) |
| InChIKey | COPZSTPXZYSDKM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |