C15H20F2N2O2 — CID 49438404
N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetamide (PubChem CID 49438404) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 49438404 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(CC(O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-10(20)18-12-4-6-19(7-5-12)9-15(21)11-2-3-13(16)14(17)8-11/h2-3,8,12,15,21H,4-7,9H2,1H3,(H,18,20) |
| InChIKey | NWHXHGWUFCWGSU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |