C21H22N2O4 — CID 175460308
4-methyl-N-[(2-nitrophenyl)-(2-oxocyclohexyl)methyl]benzamide (PubChem CID 175460308) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-methyl-N-[(2-nitrophenyl)-(2-oxocyclohexyl)methyl]benzamide.
| Compound Name | 4-methyl-N-[(2-nitrophenyl)-(2-oxocyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 175460308 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-methyl-N-[(2-nitrophenyl)-(2-oxocyclohexyl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccccc2[N+](=O)[O-])C2CCCCC2=O)cc1 |
| InChI | InChI=1S/C21H22N2O4/c1-14-10-12-15(13-11-14)21(25)22-20(17-7-3-5-9-19(17)24)16-6-2-4-8-18(16)23(26)27/h2,4,6,8,10-13,17,20H,3,5,7,9H2,1H3,(H,22,25) |
| InChIKey | PDRRAINUXRNWMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|