C18H23NO5 — CID 15974561
ethyl (2S)-2-hydroxy-2-[(2E)-2-phenylmethoxycarbonyliminocyclohexyl]acetate (PubChem CID 15974561) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-2-[(2E)-2-phenylmethoxycarbonyliminocyclohexyl]acetate.
| Compound Name | ethyl (2S)-2-hydroxy-2-[(2E)-2-phenylmethoxycarbonyliminocyclohexyl]acetate |
|---|---|
| PubChem CID | 15974561 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl (2S)-2-hydroxy-2-[(2E)-2-phenylmethoxycarbonyliminocyclohexyl]acetate |
| SMILES | CCOC(=O)[C@@H](O)C1CCCC/C1=N\C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-2-23-17(21)16(20)14-10-6-7-11-15(14)19-18(22)24-12-13-8-4-3-5-9-13/h3-5,8-9,14,16,20H,2,6-7,10-12H2,1H3/b19-15+/t14?,16-/m0/s1 |
| InChIKey | MNVBVRAZJOEUKS-NWTCITEKSA-N |
| XLogP | 2.88 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|