C20H21NO5 — CID 58839402
ethyl (4Z)-2-hydroxy-4-phenyl-4-phenylmethoxycarbonyliminobutanoate (PubChem CID 58839402) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is ethyl (4Z)-2-hydroxy-4-phenyl-4-phenylmethoxycarbonyliminobutanoate.
| Compound Name | ethyl (4Z)-2-hydroxy-4-phenyl-4-phenylmethoxycarbonyliminobutanoate |
|---|---|
| PubChem CID | 58839402 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethyl (4Z)-2-hydroxy-4-phenyl-4-phenylmethoxycarbonyliminobutanoate |
| SMILES | CCOC(=O)C(O)C/C(=N/C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c1-2-25-19(23)18(22)13-17(16-11-7-4-8-12-16)21-20(24)26-14-15-9-5-3-6-10-15/h3-12,18,22H,2,13-14H2,1H3/b21-17- |
| InChIKey | SHEWFJBBVZIGOH-FXBPSFAMSA-N |
| XLogP | 3.13 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|