C21H22ClNO5 — CID 135054702
ethyl (2S,3R,4Z)-4-(4-chlorophenyl)-2-hydroxy-3-methyl-4-phenylmethoxycarbonyliminobutanoate (PubChem CID 135054702) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is ethyl (2S,3R,4Z)-4-(4-chlorophenyl)-2-hydroxy-3-methyl-4-phenylmethoxycarbonyliminobutanoate.
| Compound Name | ethyl (2S,3R,4Z)-4-(4-chlorophenyl)-2-hydroxy-3-methyl-4-phenylmethoxycarbonyliminobutanoate |
|---|---|
| PubChem CID | 135054702 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl (2S,3R,4Z)-4-(4-chlorophenyl)-2-hydroxy-3-methyl-4-phenylmethoxycarbonyliminobutanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](C)/C(=N/C(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO5/c1-3-27-20(25)19(24)14(2)18(16-9-11-17(22)12-10-16)23-21(26)28-13-15-7-5-4-6-8-15/h4-12,14,19,24H,3,13H2,1-2H3/b23-18-/t14-,19+/m1/s1 |
| InChIKey | KWJFDRIKOPXTEG-XXVYYJMBSA-N |
| XLogP | 4.03 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|