C20H20ClNO5 — CID 135055215
ethyl (2S,4Z)-4-(4-chlorophenyl)-2-hydroxy-4-phenylmethoxycarbonyliminobutanoate (PubChem CID 135055215) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is ethyl (2S,4Z)-4-(4-chlorophenyl)-2-hydroxy-4-phenylmethoxycarbonyliminobutanoate.
| Compound Name | ethyl (2S,4Z)-4-(4-chlorophenyl)-2-hydroxy-4-phenylmethoxycarbonyliminobutanoate |
|---|---|
| PubChem CID | 135055215 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | ethyl (2S,4Z)-4-(4-chlorophenyl)-2-hydroxy-4-phenylmethoxycarbonyliminobutanoate |
| SMILES | CCOC(=O)[C@@H](O)C/C(=N/C(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO5/c1-2-26-19(24)18(23)12-17(15-8-10-16(21)11-9-15)22-20(25)27-13-14-6-4-3-5-7-14/h3-11,18,23H,2,12-13H2,1H3/b22-17-/t18-/m0/s1 |
| InChIKey | RPQGWJLWXDNSNB-LSOGNMMWSA-N |
| XLogP | 3.78 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|