C10H9Cl6O3P — CID 2783809
2,2,2-trichloro-1-[phenyl-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]ethanol (PubChem CID 2783809) has the molecular formula C10H9Cl6O3P and a molecular weight of 420.87 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[phenyl-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]ethanol.
| Compound Name | 2,2,2-trichloro-1-[phenyl-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]ethanol |
|---|---|
| PubChem CID | 2783809 |
| Molecular Formula | C10H9Cl6O3P |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 417.84 |
| IUPAC Name | 2,2,2-trichloro-1-[phenyl-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]ethanol |
| SMILES | O=P(c1ccccc1)(C(O)C(Cl)(Cl)Cl)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl6O3P/c11-9(12,13)7(17)20(19,8(18)10(14,15)16)6-4-2-1-3-5-6/h1-5,7-8,17-18H |
| InChIKey | BEGVOGHFSJFHJI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|