About (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione
(2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione (PubChem CID 154429680) has the molecular formula C15H23N2O5P
and a molecular weight of 342.33 g/mol. Its IUPAC name is (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione.
Molecular Properties
| Compound Name | (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione |
| PubChem CID | 154429680 |
| Molecular Formula | C15H23N2O5P |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione |
| SMILES | CCOP(=O)(OCC)C(=O)[C@](N)(Cc1ccccc1)C(=O)CN |
| InChI | InChI=1S/C15H23N2O5P/c1-3-21-23(20,22-4-2)14(19)15(17,13(18)11-16)10-12-8-6-5-7-9-12/h5-9H,3-4,10-11,16-17H2,1-2H3/t15-/m0/s1 |
| InChIKey | SGKLQTXECBUVEL-HNNXBMFYSA-N |
| XLogP | 1.25 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione?
The IUPAC name of (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione (CID 154429680) is (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione.
What is the SMILES notation for (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione?
The canonical SMILES for (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione is CCOP(=O)(OCC)C(=O)[C@](N)(Cc1ccccc1)C(=O)CN.
What is the InChIKey of (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione?
The InChIKey is SGKLQTXECBUVEL-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H23N2O5P/c1-3-21-23(20,22-4-2)14(19)15(17,13(18)11-16)10-12-8-6-5-7-9-12/h5-9H,3-4,10-11,16-17H2,1-2H3/t15-/m0/s1.
What are the key properties of (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione?
(2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione has a molecular weight of 342.33 g/mol, XLogP of 1.25, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-diamino-2-benzyl-1-diethoxyphosphorylbutane-1,3-dione is sourced from PubChem (CID 154429680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).