C27H29N2O2P — CID 23746527
N-[[[4-(dimethylamino)phenyl]-ethoxyphosphoryl]-phenylmethyl]naphthalen-2-amine (PubChem CID 23746527) has the molecular formula C27H29N2O2P and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[[[4-(dimethylamino)phenyl]-ethoxyphosphoryl]-phenylmethyl]naphthalen-2-amine.
| Compound Name | N-[[[4-(dimethylamino)phenyl]-ethoxyphosphoryl]-phenylmethyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 23746527 |
| Molecular Formula | C27H29N2O2P |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[[[4-(dimethylamino)phenyl]-ethoxyphosphoryl]-phenylmethyl]naphthalen-2-amine |
| SMILES | CCOP(=O)(c1ccc(N(C)C)cc1)C(Nc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H29N2O2P/c1-4-31-32(30,26-18-16-25(17-19-26)29(2)3)27(22-11-6-5-7-12-22)28-24-15-14-21-10-8-9-13-23(21)20-24/h5-20,27-28H,4H2,1-3H3 |
| InChIKey | AFEOGKIQRCHHIJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|