C26H31Cl2N2O2P — CID 5100468
4-[[anilino-(2,6-dichlorophenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline (PubChem CID 5100468) has the molecular formula C26H31Cl2N2O2P and a molecular weight of 505.43 g/mol. Its IUPAC name is 4-[[anilino-(2,6-dichlorophenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[anilino-(2,6-dichlorophenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 5100468 |
| Molecular Formula | C26H31Cl2N2O2P |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 4-[[anilino-(2,6-dichlorophenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)CCOP(=O)(c1ccc(N(C)C)cc1)C(Nc1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H31Cl2N2O2P/c1-19(2)17-18-32-33(31,22-15-13-21(14-16-22)30(3)4)26(29-20-9-6-5-7-10-20)25-23(27)11-8-12-24(25)28/h5-16,19,26,29H,17-18H2,1-4H3 |
| InChIKey | SNAWTIXGFLDBGK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|