C28H34BrN2O3P — CID 71607939
N-[(6-bromo-9-ethylcarbazol-3-yl)-diethoxyphosphorylmethyl]-4-propan-2-ylaniline (PubChem CID 71607939) has the molecular formula C28H34BrN2O3P and a molecular weight of 557.47 g/mol. Its IUPAC name is N-[(6-bromo-9-ethylcarbazol-3-yl)-diethoxyphosphorylmethyl]-4-propan-2-ylaniline.
| Compound Name | N-[(6-bromo-9-ethylcarbazol-3-yl)-diethoxyphosphorylmethyl]-4-propan-2-ylaniline |
|---|---|
| PubChem CID | 71607939 |
| Molecular Formula | C28H34BrN2O3P |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[(6-bromo-9-ethylcarbazol-3-yl)-diethoxyphosphorylmethyl]-4-propan-2-ylaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(C(C)C)cc1)c1ccc2c(c1)c1cc(Br)ccc1n2CC |
| InChI | InChI=1S/C28H34BrN2O3P/c1-6-31-26-15-11-21(17-24(26)25-18-22(29)12-16-27(25)31)28(35(32,33-7-2)34-8-3)30-23-13-9-20(10-14-23)19(4)5/h9-19,28,30H,6-8H2,1-5H3 |
| InChIKey | KTBJFGWNBNBBJG-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|