C17H16ClNO — CID 45101575
(3R)-3-(2-chlorophenyl)-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 45101575) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | (3R)-3-(2-chlorophenyl)-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 45101575 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | OCC[C@@H](c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16ClNO/c18-16-7-3-1-5-13(16)12(9-10-20)15-11-19-17-8-4-2-6-14(15)17/h1-8,11-12,19-20H,9-10H2/t12-/m0/s1 |
| InChIKey | ZTDOFXYJXIFRMV-LBPRGKRZSA-N |
| XLogP | 4.34 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |