C19H25ClN2 — CID 82160421
4-[3-amino-2-(4-chlorophenyl)propyl]-N,N-diethylaniline (PubChem CID 82160421) has the molecular formula C19H25ClN2 and a molecular weight of 316.88 g/mol. Its IUPAC name is 4-[3-amino-2-(4-chlorophenyl)propyl]-N,N-diethylaniline.
| Compound Name | 4-[3-amino-2-(4-chlorophenyl)propyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 82160421 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-[3-amino-2-(4-chlorophenyl)propyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CC(CN)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H25ClN2/c1-3-22(4-2)19-11-5-15(6-12-19)13-17(14-21)16-7-9-18(20)10-8-16/h5-12,17H,3-4,13-14,21H2,1-2H3 |
| InChIKey | IRYQIIVBVAWUER-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|