C23H34Cl3N3 — CID 21448537
4-[3-(4-chlorophenyl)-2-piperazin-1-ylpropyl]-N,N-diethylaniline;dihydrochloride (PubChem CID 21448537) has the molecular formula C23H34Cl3N3 and a molecular weight of 458.91 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-2-piperazin-1-ylpropyl]-N,N-diethylaniline;dihydrochloride.
| Compound Name | 4-[3-(4-chlorophenyl)-2-piperazin-1-ylpropyl]-N,N-diethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 21448537 |
| Molecular Formula | C23H34Cl3N3 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-2-piperazin-1-ylpropyl]-N,N-diethylaniline;dihydrochloride |
| SMILES | CCN(CC)c1ccc(CC(Cc2ccc(Cl)cc2)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C23H32ClN3.2ClH/c1-3-26(4-2)22-11-7-20(8-12-22)18-23(27-15-13-25-14-16-27)17-19-5-9-21(24)10-6-19;;/h5-12,23,25H,3-4,13-18H2,1-2H3;2*1H |
| InChIKey | YAMQTNSZIZJOCJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|