C19H33N3O — CID 171284953
5-(diethylamino)-2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol (PubChem CID 171284953) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol |
|---|---|
| PubChem CID | 171284953 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 5-(diethylamino)-2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]phenol |
| SMILES | CCN(CC)c1ccc([C@H](N2CCNCC2)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C19H33N3O/c1-6-21(7-2)15-8-9-16(17(23)14-15)18(19(3,4)5)22-12-10-20-11-13-22/h8-9,14,18,20,23H,6-7,10-13H2,1-5H3/t18-/m0/s1 |
| InChIKey | ZIHRLISPDAHJJO-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|