C19H35Cl2N3O — CID 171307249
5-(diethylamino)-2-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride (PubChem CID 171307249) has the molecular formula C19H35Cl2N3O and a molecular weight of 392.42 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride.
| Compound Name | 5-(diethylamino)-2-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307249 |
| Molecular Formula | C19H35Cl2N3O |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 5-(diethylamino)-2-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
| SMILES | CCCC[C@H](c1ccc(N(CC)CC)cc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H33N3O.2ClH/c1-4-7-8-18(22-13-11-20-12-14-22)17-10-9-16(15-19(17)23)21(5-2)6-3;;/h9-10,15,18,20,23H,4-8,11-14H2,1-3H3;2*1H/t18-;;/m1../s1 |
| InChIKey | WMJHPTWKFMJGPK-JPKZNVRTSA-N |
| XLogP | 4.22 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|