C13H24ClN3 — CID 171207945
(1R)-1-[4-(diethylamino)phenyl]propane-1,3-diamine;hydrochloride (PubChem CID 171207945) has the molecular formula C13H24ClN3 and a molecular weight of 257.81 g/mol. Its IUPAC name is (1R)-1-[4-(diethylamino)phenyl]propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-[4-(diethylamino)phenyl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171207945 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (1R)-1-[4-(diethylamino)phenyl]propane-1,3-diamine;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@H](N)CCN)cc1.Cl |
| InChI | InChI=1S/C13H23N3.ClH/c1-3-16(4-2)12-7-5-11(6-8-12)13(15)9-10-14;/h5-8,13H,3-4,9-10,14-15H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | IRUWTCYEGOOMLG-BTQNPOSSSA-N |
| XLogP | 2.30 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|