C15H27ClN2 — CID 171227543
4-[(1S)-1-amino-3-methylbutyl]-N,N-diethylaniline;hydrochloride (PubChem CID 171227543) has the molecular formula C15H27ClN2 and a molecular weight of 270.85 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-methylbutyl]-N,N-diethylaniline;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3-methylbutyl]-N,N-diethylaniline;hydrochloride |
|---|---|
| PubChem CID | 171227543 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-[(1S)-1-amino-3-methylbutyl]-N,N-diethylaniline;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)CC(C)C)cc1.Cl |
| InChI | InChI=1S/C15H26N2.ClH/c1-5-17(6-2)14-9-7-13(8-10-14)15(16)11-12(3)4;/h7-10,12,15H,5-6,11,16H2,1-4H3;1H/t15-;/m0./s1 |
| InChIKey | DBCWAPXWXUJUMD-RSAXXLAASA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|