C27H34ClN3 — CID 20537704
4-[(4-chloroanilino)-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline (PubChem CID 20537704) has the molecular formula C27H34ClN3 and a molecular weight of 436.04 g/mol. Its IUPAC name is 4-[(4-chloroanilino)-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[(4-chloroanilino)-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 20537704 |
| Molecular Formula | C27H34ClN3 |
| Molecular Weight | 436.04 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-[(4-chloroanilino)-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(Nc2ccc(Cl)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C27H34ClN3/c1-5-30(6-2)25-17-9-21(10-18-25)27(29-24-15-13-23(28)14-16-24)22-11-19-26(20-12-22)31(7-3)8-4/h9-20,27,29H,5-8H2,1-4H3 |
| InChIKey | QNBPPCVBEYOZCV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.04 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|