C21H32N4 — CID 53403073
4-[[4-(diethylamino)phenyl]-hydrazinylmethyl]-N,N-diethylaniline (PubChem CID 53403073) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 4-[[4-(diethylamino)phenyl]-hydrazinylmethyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-(diethylamino)phenyl]-hydrazinylmethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 53403073 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4-[[4-(diethylamino)phenyl]-hydrazinylmethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(NN)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C21H32N4/c1-5-24(6-2)19-13-9-17(10-14-19)21(23-22)18-11-15-20(16-12-18)25(7-3)8-4/h9-16,21,23H,5-8,22H2,1-4H3 |
| InChIKey | XLBGKTWYPGVWHW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|