C25H38N2 — CID 91741933
4-[1-[4-(diethylamino)phenyl]-2,2-dimethylpropyl]-N,N-diethylaniline (PubChem CID 91741933) has the molecular formula C25H38N2 and a molecular weight of 366.59 g/mol. Its IUPAC name is 4-[1-[4-(diethylamino)phenyl]-2,2-dimethylpropyl]-N,N-diethylaniline.
| Compound Name | 4-[1-[4-(diethylamino)phenyl]-2,2-dimethylpropyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 91741933 |
| Molecular Formula | C25H38N2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 4-[1-[4-(diethylamino)phenyl]-2,2-dimethylpropyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H38N2/c1-8-26(9-2)22-16-12-20(13-17-22)24(25(5,6)7)21-14-18-23(19-15-21)27(10-3)11-4/h12-19,24H,8-11H2,1-7H3 |
| InChIKey | IGKOPJWNURSOFG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|