C20H28N2O — CID 83974047
4-[3-amino-2-(4-ethoxy-3-methylphenyl)propyl]-N,N-dimethylaniline (PubChem CID 83974047) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-[3-amino-2-(4-ethoxy-3-methylphenyl)propyl]-N,N-dimethylaniline.
| Compound Name | 4-[3-amino-2-(4-ethoxy-3-methylphenyl)propyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 83974047 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4-[3-amino-2-(4-ethoxy-3-methylphenyl)propyl]-N,N-dimethylaniline |
| SMILES | CCOc1ccc(C(CN)Cc2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C20H28N2O/c1-5-23-20-11-8-17(12-15(20)2)18(14-21)13-16-6-9-19(10-7-16)22(3)4/h6-12,18H,5,13-14,21H2,1-4H3 |
| InChIKey | OMJINZNGVFEKRH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|