C18H22FN — CID 82140480
3-(3-fluorophenyl)-2-(2,4,6-trimethylphenyl)propan-1-amine (PubChem CID 82140480) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-(2,4,6-trimethylphenyl)propan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-2-(2,4,6-trimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 82140480 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-(3-fluorophenyl)-2-(2,4,6-trimethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)c(C(CN)Cc2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C18H22FN/c1-12-7-13(2)18(14(3)8-12)16(11-20)9-15-5-4-6-17(19)10-15/h4-8,10,16H,9,11,20H2,1-3H3 |
| InChIKey | PPQGSDHUAAZKSA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |