C15H22F2N2O — CID 102965275
2-[3-(difluoromethyl)phenyl]-2-(3-methoxypiperidin-1-yl)ethanamine (PubChem CID 102965275) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-2-(3-methoxypiperidin-1-yl)ethanamine.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-2-(3-methoxypiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102965275 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-2-(3-methoxypiperidin-1-yl)ethanamine |
| SMILES | COC1CCCN(C(CN)c2cccc(C(F)F)c2)C1 |
| InChI | InChI=1S/C15H22F2N2O/c1-20-13-6-3-7-19(10-13)14(9-18)11-4-2-5-12(8-11)15(16)17/h2,4-5,8,13-15H,3,6-7,9-10,18H2,1H3 |
| InChIKey | LFGVMHJPZSIEOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |