C14H18F3NOS2 — CID 115387502
(3-ethyl-1,4-dithian-2-yl)-[3-(trifluoromethoxy)phenyl]methanamine (PubChem CID 115387502) has the molecular formula C14H18F3NOS2 and a molecular weight of 337.43 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-[3-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-[3-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 115387502 |
| Molecular Formula | C14H18F3NOS2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-[3-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CCC1SCCSC1C(N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NOS2/c1-2-11-13(21-7-6-20-11)12(18)9-4-3-5-10(8-9)19-14(15,16)17/h3-5,8,11-13H,2,6-7,18H2,1H3 |
| InChIKey | MNEBCTQYYSTDIU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |