C16H23NOS — CID 103595728
(2-cyclobutylphenyl)-(4-methylthiomorpholin-3-yl)methanol (PubChem CID 103595728) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(4-methylthiomorpholin-3-yl)methanol.
| Compound Name | (2-cyclobutylphenyl)-(4-methylthiomorpholin-3-yl)methanol |
|---|---|
| PubChem CID | 103595728 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2-cyclobutylphenyl)-(4-methylthiomorpholin-3-yl)methanol |
| SMILES | CN1CCSCC1C(O)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C16H23NOS/c1-17-9-10-19-11-15(17)16(18)14-8-3-2-7-13(14)12-5-4-6-12/h2-3,7-8,12,15-16,18H,4-6,9-11H2,1H3 |
| InChIKey | ROMCNEKTXOBJDE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |