C12H19BrN2S2 — CID 106444806
2-(4-bromothiophen-2-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine (PubChem CID 106444806) has the molecular formula C12H19BrN2S2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
|---|---|
| PubChem CID | 106444806 |
| Molecular Formula | C12H19BrN2S2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
| SMILES | CNC(Cc1cc(Br)cs1)C1CSCCN1C |
| InChI | InChI=1S/C12H19BrN2S2/c1-14-11(6-10-5-9(13)7-17-10)12-8-16-4-3-15(12)2/h5,7,11-12,14H,3-4,6,8H2,1-2H3 |
| InChIKey | GWHKSDWTQUIFIF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |