C11H16BrNS — CID 64986632
2-(3-bromothiophen-2-yl)-1-cyclobutyl-N-methylethanamine (PubChem CID 64986632) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-cyclobutyl-N-methylethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-cyclobutyl-N-methylethanamine |
|---|---|
| PubChem CID | 64986632 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-cyclobutyl-N-methylethanamine |
| SMILES | CNC(Cc1sccc1Br)C1CCC1 |
| InChI | InChI=1S/C11H16BrNS/c1-13-10(8-3-2-4-8)7-11-9(12)5-6-14-11/h5-6,8,10,13H,2-4,7H2,1H3 |
| InChIKey | MWAASMDKWOKVQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |