C15H23BrN2S — CID 112681190
2-(3-bromothiophen-2-yl)-N-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanamine (PubChem CID 112681190) has the molecular formula C15H23BrN2S and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-N-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanamine |
|---|---|
| PubChem CID | 112681190 |
| Molecular Formula | C15H23BrN2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanamine |
| SMILES | CNC(Cc1sccc1Br)C1CC2CCC(C1)N2C |
| InChI | InChI=1S/C15H23BrN2S/c1-17-14(9-15-13(16)5-6-19-15)10-7-11-3-4-12(8-10)18(11)2/h5-6,10-12,14,17H,3-4,7-9H2,1-2H3 |
| InChIKey | YPJNIFJWPCUZGK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |