C18H23N3O4 — CID 58632923
(2S)-2-[[(1S)-1-carboxy-2-(1-phenylpyrazol-3-yl)ethyl]amino]-4-methylpentanoic acid (PubChem CID 58632923) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-2-(1-phenylpyrazol-3-yl)ethyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-2-(1-phenylpyrazol-3-yl)ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 58632923 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-2-(1-phenylpyrazol-3-yl)ethyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](N[C@@H](Cc1ccn(-c2ccccc2)n1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H23N3O4/c1-12(2)10-15(17(22)23)19-16(18(24)25)11-13-8-9-21(20-13)14-6-4-3-5-7-14/h3-9,12,15-16,19H,10-11H2,1-2H3,(H,22,23)(H,24,25)/t15-,16-/m0/s1 |
| InChIKey | ASDICQQKMMSWOP-HOTGVXAUSA-N |
| XLogP | 1.96 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |