C15H16FN3O3S — CID 19514502
ethyl (2R)-2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 19514502) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl (2R)-2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19514502 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | ethyl (2R)-2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C15H16FN3O3S/c1-2-22-15(21)13(8-23)17-14(20)12-7-11(18-19-12)9-3-5-10(16)6-4-9/h3-7,13,23H,2,8H2,1H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | FTNDHWBAJAKNQT-ZDUSSCGKSA-N |
| XLogP | 1.81 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|