C16H19N3O3 — CID 119194391
(2S,3S)-3-methyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoic acid (PubChem CID 119194391) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119194391 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cc(-c2ccccc2)n[nH]1)C(=O)O |
| InChI | InChI=1S/C16H19N3O3/c1-3-10(2)14(16(21)22)17-15(20)13-9-12(18-19-13)11-7-5-4-6-8-11/h4-10,14H,3H2,1-2H3,(H,17,20)(H,18,19)(H,21,22)/t10-,14-/m0/s1 |
| InChIKey | BIHTUWUTKPHANK-HZMBPMFUSA-N |
| XLogP | 2.31 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |