C16H19N3O3 — CID 119170236
3-methyl-2-[[3-(4-methylphenyl)-1H-pyrazole-5-carbonyl]amino]butanoic acid (PubChem CID 119170236) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-methyl-2-[[3-(4-methylphenyl)-1H-pyrazole-5-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[3-(4-methylphenyl)-1H-pyrazole-5-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119170236 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-methyl-2-[[3-(4-methylphenyl)-1H-pyrazole-5-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C(=O)O)C(C)C)[nH]n2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-9(2)14(16(21)22)17-15(20)13-8-12(18-19-13)11-6-4-10(3)5-7-11/h4-9,14H,1-3H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | SUMGPFQZDHGOHS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |