C10H14ClN3O3S — CID 19475846
ethyl (2R)-2-[(4-chloro-1-methylpyrazole-5-carbonyl)amino]-3-sulfanylpropanoate (PubChem CID 19475846) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is ethyl (2R)-2-[(4-chloro-1-methylpyrazole-5-carbonyl)amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[(4-chloro-1-methylpyrazole-5-carbonyl)amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19475846 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | ethyl (2R)-2-[(4-chloro-1-methylpyrazole-5-carbonyl)amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H14ClN3O3S/c1-3-17-10(16)7(5-18)13-9(15)8-6(11)4-12-14(8)2/h4,7,18H,3,5H2,1-2H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | FVLFTCXBCKPTHG-ZETCQYMHSA-N |
| XLogP | 0.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|