C10H13Cl2N3O2 — CID 18776930
N-butan-2-yl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (PubChem CID 18776930) has the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is N-butan-2-yl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 18776930 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-butan-2-yl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-3-6(2)14-8(16)5-15-10(17)9(12)7(11)4-13-15/h4,6H,3,5H2,1-2H3,(H,14,16) |
| InChIKey | BZPZRHIAAFKVJO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |