C9H18N2O3S2 — CID 87759744
ethyl (2R)-3-sulfanyl-2-[[2-(2-sulfanylethylamino)acetyl]amino]propanoate (PubChem CID 87759744) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is ethyl (2R)-3-sulfanyl-2-[[2-(2-sulfanylethylamino)acetyl]amino]propanoate.
| Compound Name | ethyl (2R)-3-sulfanyl-2-[[2-(2-sulfanylethylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 87759744 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | ethyl (2R)-3-sulfanyl-2-[[2-(2-sulfanylethylamino)acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)CNCCS |
| InChI | InChI=1S/C9H18N2O3S2/c1-2-14-9(13)7(6-16)11-8(12)5-10-3-4-15/h7,10,15-16H,2-6H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | MJOAFYZAUWGKRL-ZETCQYMHSA-N |
| XLogP | -0.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|