C12H18N4O5S — CID 19568065
ethyl (2R)-2-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]-3-sulfanylpropanoate (PubChem CID 19568065) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is ethyl (2R)-2-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19568065 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | ethyl (2R)-2-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)CCn1ncc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H18N4O5S/c1-3-21-12(18)9(7-22)14-11(17)4-5-15-8(2)10(6-13-15)16(19)20/h6,9,22H,3-5,7H2,1-2H3,(H,14,17)/t9-/m0/s1 |
| InChIKey | ISBDEXNTBIWWHT-VIFPVBQESA-N |
| XLogP | 0.47 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|