C9H12N4O5S — CID 19479562
ethyl (2R)-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]-3-sulfanylpropanoate (PubChem CID 19479562) has the molecular formula C9H12N4O5S and a molecular weight of 288.29 g/mol. Its IUPAC name is ethyl (2R)-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19479562 |
| Molecular Formula | C9H12N4O5S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | ethyl (2R)-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O5S/c1-2-18-9(15)5(4-19)11-8(14)7-6(13(16)17)3-10-12-7/h3,5,19H,2,4H2,1H3,(H,10,12)(H,11,14)/t5-/m0/s1 |
| InChIKey | NIRHGYLDBXFLNB-YFKPBYRVSA-N |
| XLogP | -0.09 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|