C14H14N6O7 — CID 19568150
N-(4-methyl-3,5-dinitrophenyl)-3-(5-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19568150) has the molecular formula C14H14N6O7 and a molecular weight of 378.30 g/mol. Its IUPAC name is N-(4-methyl-3,5-dinitrophenyl)-3-(5-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-(4-methyl-3,5-dinitrophenyl)-3-(5-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19568150 |
| Molecular Formula | C14H14N6O7 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-(4-methyl-3,5-dinitrophenyl)-3-(5-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)CCn2ncc([N+](=O)[O-])c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N6O7/c1-8-11(18(22)23)5-10(6-12(8)19(24)25)16-14(21)3-4-17-9(2)13(7-15-17)20(26)27/h5-7H,3-4H2,1-2H3,(H,16,21) |
| InChIKey | BAFJENZUVMPQNW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|