C11H19N3O5 — CID 168928235
(4R)-4-(methylamino)-5-oxo-5-[[2-oxo-2-(2-oxopropylamino)ethyl]amino]pentanoic acid (PubChem CID 168928235) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is (4R)-4-(methylamino)-5-oxo-5-[[2-oxo-2-(2-oxopropylamino)ethyl]amino]pentanoic acid.
| Compound Name | (4R)-4-(methylamino)-5-oxo-5-[[2-oxo-2-(2-oxopropylamino)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 168928235 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (4R)-4-(methylamino)-5-oxo-5-[[2-oxo-2-(2-oxopropylamino)ethyl]amino]pentanoic acid |
| SMILES | CN[C@H](CCC(=O)O)C(=O)NCC(=O)NCC(C)=O |
| InChI | InChI=1S/C11H19N3O5/c1-7(15)5-13-9(16)6-14-11(19)8(12-2)3-4-10(17)18/h8,12H,3-6H2,1-2H3,(H,13,16)(H,14,19)(H,17,18)/t8-/m1/s1 |
| InChIKey | RWHQERPQGXATFS-MRVPVSSYSA-N |
| XLogP | -1.74 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |