C9H21NO4 — CID 170591176
2-hydroxyacetaldehyde;2-(methylamino)propanoic acid;propane (PubChem CID 170591176) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-hydroxyacetaldehyde;2-(methylamino)propanoic acid;propane.
| Compound Name | 2-hydroxyacetaldehyde;2-(methylamino)propanoic acid;propane |
|---|---|
| PubChem CID | 170591176 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 2-hydroxyacetaldehyde;2-(methylamino)propanoic acid;propane |
| SMILES | CCC.CNC(C)C(=O)O.O=CCO |
| InChI | InChI=1S/C4H9NO2.C3H8.C2H4O2/c1-3(5-2)4(6)7;1-3-2;3-1-2-4/h3,5H,1-2H3,(H,6,7);3H2,1-2H3;1,4H,2H2 |
| InChIKey | HFRHXMCXZNPLGE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|