About 2-(methylamino)acetaldehyde;2-methylpropanoic acid
2-(methylamino)acetaldehyde;2-methylpropanoic acid (PubChem CID 23463592) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(methylamino)acetaldehyde;2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-(methylamino)acetaldehyde;2-methylpropanoic acid |
| PubChem CID | 23463592 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 2-(methylamino)acetaldehyde;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.CNCC=O |
| InChI | InChI=1S/C4H8O2.C3H7NO/c1-3(2)4(5)6;1-4-2-3-5/h3H,1-2H3,(H,5,6);3-4H,2H2,1H3 |
| InChIKey | JKWGVPFYIFLGAA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)acetaldehyde;2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)acetaldehyde;2-methylpropanoic acid?
The IUPAC name of 2-(methylamino)acetaldehyde;2-methylpropanoic acid (CID 23463592) is 2-(methylamino)acetaldehyde;2-methylpropanoic acid.
What is the SMILES notation for 2-(methylamino)acetaldehyde;2-methylpropanoic acid?
The canonical SMILES for 2-(methylamino)acetaldehyde;2-methylpropanoic acid is CC(C)C(=O)O.CNCC=O.
What is the InChIKey of 2-(methylamino)acetaldehyde;2-methylpropanoic acid?
The InChIKey is JKWGVPFYIFLGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H7NO/c1-3(2)4(5)6;1-4-2-3-5/h3H,1-2H3,(H,5,6);3-4H,2H2,1H3.
What are the key properties of 2-(methylamino)acetaldehyde;2-methylpropanoic acid?
2-(methylamino)acetaldehyde;2-methylpropanoic acid has a molecular weight of 161.20 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)acetaldehyde;2-methylpropanoic acid is sourced from PubChem (CID 23463592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).